C22H27NO2 — CID 126125593
N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-4-methylaniline (PubChem CID 126125593) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-4-methylaniline.
| Compound Name | N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-4-methylaniline |
|---|---|
| PubChem CID | 126125593 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-4-methylaniline |
| SMILES | C=CCOc1c(CC=C)cc(CNc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C22H27NO2/c1-5-8-19-14-18(16-23-20-11-9-17(4)10-12-20)15-21(24-7-3)22(19)25-13-6-2/h5-6,9-12,14-15,23H,1-2,7-8,13,16H2,3-4H3 |
| InChIKey | SMDAPXBBDPHCGP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|