C27H31NO5S — CID 126125792
[2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126125792) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is [2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126125792 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(CNc2ccc(OCC)cc2)cc(OCC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H31NO5S/c1-5-8-22-17-21(19-28-23-11-13-24(14-12-23)31-6-2)18-26(32-7-3)27(22)33-34(29,30)25-15-9-20(4)10-16-25/h5,9-18,28H,1,6-8,19H2,2-4H3 |
| InChIKey | PJTQFELMNSLWMU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|