C27H31NO4S — CID 126124320
[2-ethoxy-4-[(2-ethylanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126124320) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is [2-ethoxy-4-[(2-ethylanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(2-ethylanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126124320 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | [2-ethoxy-4-[(2-ethylanilino)methyl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(CNc2ccccc2CC)cc(OCC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H31NO4S/c1-5-10-23-17-21(19-28-25-12-9-8-11-22(25)6-2)18-26(31-7-3)27(23)32-33(29,30)24-15-13-20(4)14-16-24/h5,8-9,11-18,28H,1,6-7,10,19H2,2-4H3 |
| InChIKey | SATUDACLKMTVSW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|