C24H26BrNO4S — CID 126137762
[2-bromo-4-[(2,3-dimethylanilino)methyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 126137762) has the molecular formula C24H26BrNO4S and a molecular weight of 504.45 g/mol. Its IUPAC name is [2-bromo-4-[(2,3-dimethylanilino)methyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-4-[(2,3-dimethylanilino)methyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126137762 |
| Molecular Formula | C24H26BrNO4S |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | [2-bromo-4-[(2,3-dimethylanilino)methyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(CNc2cccc(C)c2C)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26BrNO4S/c1-5-29-23-14-19(15-26-22-8-6-7-17(3)18(22)4)13-21(25)24(23)30-31(27,28)20-11-9-16(2)10-12-20/h6-14,26H,5,15H2,1-4H3 |
| InChIKey | JNFKIZSFLAWTNJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|