C19H24BrNO2 — CID 1210744
N-[(3-bromo-4,5-diethoxyphenyl)methyl]-2,4-dimethylaniline (PubChem CID 1210744) has the molecular formula C19H24BrNO2 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[(3-bromo-4,5-diethoxyphenyl)methyl]-2,4-dimethylaniline.
| Compound Name | N-[(3-bromo-4,5-diethoxyphenyl)methyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 1210744 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[(3-bromo-4,5-diethoxyphenyl)methyl]-2,4-dimethylaniline |
| SMILES | CCOc1cc(CNc2ccc(C)cc2C)cc(Br)c1OCC |
| InChI | InChI=1S/C19H24BrNO2/c1-5-22-18-11-15(10-16(20)19(18)23-6-2)12-21-17-8-7-13(3)9-14(17)4/h7-11,21H,5-6,12H2,1-4H3 |
| InChIKey | HXLXQLSOQQZQIX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |