C17H20BrNO — CID 126127933
N-[(3-bromo-4-ethoxyphenyl)methyl]-2,3-dimethylaniline (PubChem CID 126127933) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxyphenyl)methyl]-2,3-dimethylaniline.
| Compound Name | N-[(3-bromo-4-ethoxyphenyl)methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 126127933 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(3-bromo-4-ethoxyphenyl)methyl]-2,3-dimethylaniline |
| SMILES | CCOc1ccc(CNc2cccc(C)c2C)cc1Br |
| InChI | InChI=1S/C17H20BrNO/c1-4-20-17-9-8-14(10-15(17)18)11-19-16-7-5-6-12(2)13(16)3/h5-10,19H,4,11H2,1-3H3 |
| InChIKey | XDUSTRIPCLKVTF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |