C18H22INO2 — CID 126124007
N-[(3-ethoxy-5-iodo-4-methoxyphenyl)methyl]-2,3-dimethylaniline (PubChem CID 126124007) has the molecular formula C18H22INO2 and a molecular weight of 411.28 g/mol. Its IUPAC name is N-[(3-ethoxy-5-iodo-4-methoxyphenyl)methyl]-2,3-dimethylaniline.
| Compound Name | N-[(3-ethoxy-5-iodo-4-methoxyphenyl)methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 126124007 |
| Molecular Formula | C18H22INO2 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-[(3-ethoxy-5-iodo-4-methoxyphenyl)methyl]-2,3-dimethylaniline |
| SMILES | CCOc1cc(CNc2cccc(C)c2C)cc(I)c1OC |
| InChI | InChI=1S/C18H22INO2/c1-5-22-17-10-14(9-15(19)18(17)21-4)11-20-16-8-6-7-12(2)13(16)3/h6-10,20H,5,11H2,1-4H3 |
| InChIKey | ONVPUOPTCOOQCZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|