C14H22INO3 — CID 11841955
2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylamino]butan-1-ol (PubChem CID 11841955) has the molecular formula C14H22INO3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylamino]butan-1-ol.
| Compound Name | 2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 11841955 |
| Molecular Formula | C14H22INO3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylamino]butan-1-ol |
| SMILES | CCOc1cc(CNC(CC)CO)cc(I)c1OC |
| InChI | InChI=1S/C14H22INO3/c1-4-11(9-17)16-8-10-6-12(15)14(18-3)13(7-10)19-5-2/h6-7,11,16-17H,4-5,8-9H2,1-3H3 |
| InChIKey | QUCCOJZVWGWNSM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|