C14H23BrClNO3 — CID 17292090
2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]butan-1-ol;hydrochloride (PubChem CID 17292090) has the molecular formula C14H23BrClNO3 and a molecular weight of 368.70 g/mol. Its IUPAC name is 2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17292090 |
| Molecular Formula | C14H23BrClNO3 |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CCOc1c(Br)cc(CNC(CC)CO)cc1OC.Cl |
| InChI | InChI=1S/C14H22BrNO3.ClH/c1-4-11(9-17)16-8-10-6-12(15)14(19-5-2)13(7-10)18-3;/h6-7,11,16-17H,4-5,8-9H2,1-3H3;1H |
| InChIKey | YTZGSWKTBQSMOS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |