C14H24ClNO3 — CID 2987537
2-[(4-ethoxy-3-methoxyphenyl)methylamino]butan-1-ol;hydrochloride (PubChem CID 2987537) has the molecular formula C14H24ClNO3 and a molecular weight of 289.80 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxyphenyl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[(4-ethoxy-3-methoxyphenyl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 2987537 |
| Molecular Formula | C14H24ClNO3 |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxyphenyl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CCOc1ccc(CNC(CC)CO)cc1OC.Cl |
| InChI | InChI=1S/C14H23NO3.ClH/c1-4-12(10-16)15-9-11-6-7-13(18-5-2)14(8-11)17-3;/h6-8,12,15-16H,4-5,9-10H2,1-3H3;1H |
| InChIKey | KZIZLWHSZRIZEZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |