C15H26ClNO3 — CID 17292093
2-[(3,4-diethoxyphenyl)methylamino]butan-1-ol;hydrochloride (PubChem CID 17292093) has the molecular formula C15H26ClNO3 and a molecular weight of 303.83 g/mol. Its IUPAC name is 2-[(3,4-diethoxyphenyl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[(3,4-diethoxyphenyl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17292093 |
| Molecular Formula | C15H26ClNO3 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[(3,4-diethoxyphenyl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CCOc1ccc(CNC(CC)CO)cc1OCC.Cl |
| InChI | InChI=1S/C15H25NO3.ClH/c1-4-13(11-17)16-10-12-7-8-14(18-5-2)15(9-12)19-6-3;/h7-9,13,16-17H,4-6,10-11H2,1-3H3;1H |
| InChIKey | FDUGGDKQEMSXKM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |