C13H22ClNO3 — CID 23623616
(2S)-2-[(3,4-dimethoxyphenyl)methylamino]butan-1-ol;hydrochloride (PubChem CID 23623616) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is (2S)-2-[(3,4-dimethoxyphenyl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | (2S)-2-[(3,4-dimethoxyphenyl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 23623616 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2S)-2-[(3,4-dimethoxyphenyl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CC[C@@H](CO)NCc1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C13H21NO3.ClH/c1-4-11(9-15)14-8-10-5-6-12(16-2)13(7-10)17-3;/h5-7,11,14-15H,4,8-9H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | JUNPRUKHHLAGSQ-MERQFXBCSA-N |
| XLogP | 1.99 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |