C13H19F2NO3 — CID 28723108
(2R)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]butan-1-ol (PubChem CID 28723108) has the molecular formula C13H19F2NO3 and a molecular weight of 275.29 g/mol. Its IUPAC name is (2R)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 28723108 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2R)-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H19F2NO3/c1-3-10(8-17)16-7-9-4-5-11(18-2)12(6-9)19-13(14)15/h4-6,10,13,16-17H,3,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | DFABPIOIMBSEHC-SNVBAGLBSA-N |
| XLogP | 2.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |