C14H19F2NO4 — CID 65054789
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]pentanoic acid (PubChem CID 65054789) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]pentanoic acid.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 65054789 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]pentanoic acid |
| SMILES | CCCC(NCc1ccc(OC)c(OC(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H19F2NO4/c1-3-4-10(13(18)19)17-8-9-5-6-11(20-2)12(7-9)21-14(15)16/h5-7,10,14,17H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | IWYVWFJGRAIDJI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |