C15H21F2NO4 — CID 120511758
(2S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]hexanoic acid (PubChem CID 120511758) has the molecular formula C15H21F2NO4 and a molecular weight of 317.33 g/mol. Its IUPAC name is (2S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]hexanoic acid.
| Compound Name | (2S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120511758 |
| Molecular Formula | C15H21F2NO4 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1ccc(OC(F)F)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C15H21F2NO4/c1-3-4-5-11(14(19)20)18-9-10-6-7-12(22-15(16)17)13(8-10)21-2/h6-8,11,15,18H,3-5,9H2,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | YUGLAXKRGSZHJY-NSHDSACASA-N |
| XLogP | 3.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |