C13H17Br2NO2 — CID 120511710
(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid (PubChem CID 120511710) has the molecular formula C13H17Br2NO2 and a molecular weight of 379.09 g/mol. Its IUPAC name is (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid.
| Compound Name | (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120511710 |
| Molecular Formula | C13H17Br2NO2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1ccc(Br)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C13H17Br2NO2/c1-2-3-4-12(13(17)18)16-8-9-5-6-10(14)11(15)7-9/h5-7,12,16H,2-4,8H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | PTPRRNGXAYLXEM-LBPRGKRZSA-N |
| XLogP | 3.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |