(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid

C13H17Br2NO2 — CID 120511710

IUPAC(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid
SMILESCCCC[C@H](NCc1ccc(Br)c(Br)c1)C(=O)O
InChIInChI=1S/C13H17Br2NO2/c1-2-3-4-12(13(17)18)16-8-9-5-6-10(14)11(15)7-9/h5-7,12,16H,2-4,8H2,1H3,(H,17,18)/t12-/m0/s1
InChIKeyPTPRRNGXAYLXEM-LBPRGKRZSA-N
MW379.09 g/mol
LogP3.94
Rot. Bonds7

About (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid

(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid (PubChem CID 120511710) has the molecular formula C13H17Br2NO2 and a molecular weight of 379.09 g/mol. Its IUPAC name is (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid.

Molecular Properties

Compound Name(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid
PubChem CID120511710
Molecular FormulaC13H17Br2NO2
Molecular Weight379.09 g/mol
Exact Mass376.96
IUPAC Name(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid
SMILESCCCC[C@H](NCc1ccc(Br)c(Br)c1)C(=O)O
InChIInChI=1S/C13H17Br2NO2/c1-2-3-4-12(13(17)18)16-8-9-5-6-10(14)11(15)7-9/h5-7,12,16H,2-4,8H2,1H3,(H,17,18)/t12-/m0/s1
InChIKeyPTPRRNGXAYLXEM-LBPRGKRZSA-N
XLogP3.94
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.09
LogP ≤ 53.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid?
The IUPAC name of (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid (CID 120511710) is (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid.
What is the SMILES notation for (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid?
The canonical SMILES for (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid is CCCC[C@H](NCc1ccc(Br)c(Br)c1)C(=O)O.
What is the InChIKey of (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid?
The InChIKey is PTPRRNGXAYLXEM-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H17Br2NO2/c1-2-3-4-12(13(17)18)16-8-9-5-6-10(14)11(15)7-9/h5-7,12,16H,2-4,8H2,1H3,(H,17,18)/t12-/m0/s1.
What are the key properties of (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid?
(2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid has a molecular weight of 379.09 g/mol, XLogP of 3.94, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3,4-dibromophenyl)methylamino]hexanoic acid is sourced from PubChem (CID 120511710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).