C13H18Br2N2O2 — CID 122039632
2-[(2-amino-3,5-dibromophenyl)methylamino]hexanoic acid (PubChem CID 122039632) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 2-[(2-amino-3,5-dibromophenyl)methylamino]hexanoic acid.
| Compound Name | 2-[(2-amino-3,5-dibromophenyl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 122039632 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 2-[(2-amino-3,5-dibromophenyl)methylamino]hexanoic acid |
| SMILES | CCCCC(NCc1cc(Br)cc(Br)c1N)C(=O)O |
| InChI | InChI=1S/C13H18Br2N2O2/c1-2-3-4-11(13(18)19)17-7-8-5-9(14)6-10(15)12(8)16/h5-6,11,17H,2-4,7,16H2,1H3,(H,18,19) |
| InChIKey | HOHTVSBFCZBTSZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|