C12H17NO4S — CID 87287970
(2R)-2-[(3,4-dimethoxyphenyl)methylamino]-3-sulfanylpropanoic acid (PubChem CID 87287970) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2R)-2-[(3,4-dimethoxyphenyl)methylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(3,4-dimethoxyphenyl)methylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87287970 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2R)-2-[(3,4-dimethoxyphenyl)methylamino]-3-sulfanylpropanoic acid |
| SMILES | COc1ccc(CN[C@@H](CS)C(=O)O)cc1OC |
| InChI | InChI=1S/C12H17NO4S/c1-16-10-4-3-8(5-11(10)17-2)6-13-9(7-18)12(14)15/h3-5,9,13,18H,6-7H2,1-2H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | KZZWUVGJWSCFTB-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|