C14H20N2O4S — CID 107769128
2-acetamido-N-[(3,4-dimethoxyphenyl)methyl]-3-sulfanylpropanamide (PubChem CID 107769128) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-acetamido-N-[(3,4-dimethoxyphenyl)methyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[(3,4-dimethoxyphenyl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769128 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-acetamido-N-[(3,4-dimethoxyphenyl)methyl]-3-sulfanylpropanamide |
| SMILES | COc1ccc(CNC(=O)C(CS)NC(C)=O)cc1OC |
| InChI | InChI=1S/C14H20N2O4S/c1-9(17)16-11(8-21)14(18)15-7-10-4-5-12(19-2)13(6-10)20-3/h4-6,11,21H,7-8H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | QIPUMDKOCHCDJQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|