C12H15N3O4S — CID 107769158
2-acetamido-N-[(4-nitrophenyl)methyl]-3-sulfanylpropanamide (PubChem CID 107769158) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-acetamido-N-[(4-nitrophenyl)methyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[(4-nitrophenyl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769158 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-acetamido-N-[(4-nitrophenyl)methyl]-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15N3O4S/c1-8(16)14-11(7-20)12(17)13-6-9-2-4-10(5-3-9)15(18)19/h2-5,11,20H,6-7H2,1H3,(H,13,17)(H,14,16) |
| InChIKey | UROKKQGHQRHBAE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|