C14H19N3O5 — CID 88742419
(2R)-2-acetamido-N-(3-hydroxypropyl)-3-(4-nitrophenyl)propanamide (PubChem CID 88742419) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R)-2-acetamido-N-(3-hydroxypropyl)-3-(4-nitrophenyl)propanamide.
| Compound Name | (2R)-2-acetamido-N-(3-hydroxypropyl)-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 88742419 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2R)-2-acetamido-N-(3-hydroxypropyl)-3-(4-nitrophenyl)propanamide |
| SMILES | CC(=O)N[C@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)NCCCO |
| InChI | InChI=1S/C14H19N3O5/c1-10(19)16-13(14(20)15-7-2-8-18)9-11-3-5-12(6-4-11)17(21)22/h3-6,13,18H,2,7-9H2,1H3,(H,15,20)(H,16,19)/t13-/m1/s1 |
| InChIKey | NLICMZMOPVWHBB-CYBMUJFWSA-N |
| XLogP | 0.14 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|