C12H15N3O5 — CID 11822044
(2R)-2-acetamido-3-hydroxy-N-[(4-nitrophenyl)methyl]propanamide (PubChem CID 11822044) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is (2R)-2-acetamido-3-hydroxy-N-[(4-nitrophenyl)methyl]propanamide.
| Compound Name | (2R)-2-acetamido-3-hydroxy-N-[(4-nitrophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 11822044 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2R)-2-acetamido-3-hydroxy-N-[(4-nitrophenyl)methyl]propanamide |
| SMILES | CC(=O)N[C@H](CO)C(=O)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15N3O5/c1-8(17)14-11(7-16)12(18)13-6-9-2-4-10(5-3-9)15(19)20/h2-5,11,16H,6-7H2,1H3,(H,13,18)(H,14,17)/t11-/m1/s1 |
| InChIKey | FGNZEAIGFRZGQZ-LLVKDONJSA-N |
| XLogP | -0.29 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|