C16H21N3O6 — CID 102347201
methyl 2-[[(2S)-2-acetamido-3-(4-nitrophenyl)propanoyl]amino]-2-methylpropanoate (PubChem CID 102347201) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-acetamido-3-(4-nitrophenyl)propanoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[(2S)-2-acetamido-3-(4-nitrophenyl)propanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 102347201 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | methyl 2-[[(2S)-2-acetamido-3-(4-nitrophenyl)propanoyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(C)=O |
| InChI | InChI=1S/C16H21N3O6/c1-10(20)17-13(14(21)18-16(2,3)15(22)25-4)9-11-5-7-12(8-6-11)19(23)24/h5-8,13H,9H2,1-4H3,(H,17,20)(H,18,21)/t13-/m0/s1 |
| InChIKey | BFBPMDNNPOWWDA-ZDUSSCGKSA-N |
| XLogP | 0.71 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|