C16H24N4O3 — CID 138590894
2-[[2-acetamido-3-[4-(aminomethyl)phenyl]propanoyl]amino]-2-methylpropanamide (PubChem CID 138590894) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[[2-acetamido-3-[4-(aminomethyl)phenyl]propanoyl]amino]-2-methylpropanamide.
| Compound Name | 2-[[2-acetamido-3-[4-(aminomethyl)phenyl]propanoyl]amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 138590894 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[[2-acetamido-3-[4-(aminomethyl)phenyl]propanoyl]amino]-2-methylpropanamide |
| SMILES | CC(=O)NC(Cc1ccc(CN)cc1)C(=O)NC(C)(C)C(N)=O |
| InChI | InChI=1S/C16H24N4O3/c1-10(21)19-13(14(22)20-16(2,3)15(18)23)8-11-4-6-12(9-17)7-5-11/h4-7,13H,8-9,17H2,1-3H3,(H2,18,23)(H,19,21)(H,20,22) |
| InChIKey | IEEGGLMPJJPINH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |