C25H34N4O9 — CID 159022172
methane;methyl (2R)-2-acetamido-3-[4-(hydroxyamino)phenyl]propanoate;methyl (2R)-2-acetamido-3-(4-nitrophenyl)propanoate (PubChem CID 159022172) has the molecular formula C25H34N4O9 and a molecular weight of 534.57 g/mol. Its IUPAC name is methane;methyl (2R)-2-acetamido-3-[4-(hydroxyamino)phenyl]propanoate;methyl (2R)-2-acetamido-3-(4-nitrophenyl)propanoate.
| Compound Name | methane;methyl (2R)-2-acetamido-3-[4-(hydroxyamino)phenyl]propanoate;methyl (2R)-2-acetamido-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 159022172 |
| Molecular Formula | C25H34N4O9 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | methane;methyl (2R)-2-acetamido-3-[4-(hydroxyamino)phenyl]propanoate;methyl (2R)-2-acetamido-3-(4-nitrophenyl)propanoate |
| SMILES | C.COC(=O)[C@@H](Cc1ccc(NO)cc1)NC(C)=O.COC(=O)[C@@H](Cc1ccc([N+](=O)[O-])cc1)NC(C)=O |
| InChI | InChI=1S/C12H14N2O5.C12H16N2O4.CH4/c1-8(15)13-11(12(16)19-2)7-9-3-5-10(6-4-9)14(17)18;1-8(15)13-11(12(16)18-2)7-9-3-5-10(14-17)6-4-9;/h3-6,11H,7H2,1-2H3,(H,13,15);3-6,11,14,17H,7H2,1-2H3,(H,13,15);1H4/t2*11-;/m11./s1 |
| InChIKey | JTVITVKKLVFYCK-ZVRYYDNZSA-N |
| XLogP | 2.16 |
| TPSA | 186.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|