C13H19NO5 — CID 82364254
2-[(3,4-dimethoxyphenyl)methylamino]-3-hydroxybutanoic acid (PubChem CID 82364254) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82364254 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylamino]-3-hydroxybutanoic acid |
| SMILES | COc1ccc(CNC(C(=O)O)C(C)O)cc1OC |
| InChI | InChI=1S/C13H19NO5/c1-8(15)12(13(16)17)14-7-9-4-5-10(18-2)11(6-9)19-3/h4-6,8,12,14-15H,7H2,1-3H3,(H,16,17) |
| InChIKey | LJDSIRSVAAMMSG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |