C14H22ClNO4 — CID 163331555
2-[(3-methoxy-4-propoxyphenyl)methylamino]propanoic acid;hydrochloride (PubChem CID 163331555) has the molecular formula C14H22ClNO4 and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-[(3-methoxy-4-propoxyphenyl)methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[(3-methoxy-4-propoxyphenyl)methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 163331555 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[(3-methoxy-4-propoxyphenyl)methylamino]propanoic acid;hydrochloride |
| SMILES | CCCOc1ccc(CNC(C)C(=O)O)cc1OC.Cl |
| InChI | InChI=1S/C14H21NO4.ClH/c1-4-7-19-12-6-5-11(8-13(12)18-3)9-15-10(2)14(16)17;/h5-6,8,10,15H,4,7,9H2,1-3H3,(H,16,17);1H |
| InChIKey | JFOMPCKHYWGZNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |