C16H25NO4 — CID 82364745
2-[(3-ethoxy-4-propoxyphenyl)methylamino]butanoic acid (PubChem CID 82364745) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-propoxyphenyl)methylamino]butanoic acid.
| Compound Name | 2-[(3-ethoxy-4-propoxyphenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 82364745 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[(3-ethoxy-4-propoxyphenyl)methylamino]butanoic acid |
| SMILES | CCCOc1ccc(CNC(CC)C(=O)O)cc1OCC |
| InChI | InChI=1S/C16H25NO4/c1-4-9-21-14-8-7-12(10-15(14)20-6-3)11-17-13(5-2)16(18)19/h7-8,10,13,17H,4-6,9,11H2,1-3H3,(H,18,19) |
| InChIKey | DXCKBPDTYDRRIZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |