C22H29NO4 — CID 99796468
(2R)-2-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylamino]-3-phenylpropanoic acid (PubChem CID 99796468) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2R)-2-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 99796468 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2R)-2-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylamino]-3-phenylpropanoic acid |
| SMILES | CCOc1cc(CN[C@H](Cc2ccccc2)C(=O)O)ccc1OCC(C)C |
| InChI | InChI=1S/C22H29NO4/c1-4-26-21-13-18(10-11-20(21)27-15-16(2)3)14-23-19(22(24)25)12-17-8-6-5-7-9-17/h5-11,13,16,19,23H,4,12,14-15H2,1-3H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | YCYSUDLDKTYJNP-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |