C19H22ClNO4 — CID 120510754
(2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-phenylpropanoic acid (PubChem CID 120510754) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 120510754 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-phenylpropanoic acid |
| SMILES | CCOc1cc(CN[C@@H](Cc2ccccc2)C(=O)O)cc(Cl)c1OC |
| InChI | InChI=1S/C19H22ClNO4/c1-3-25-17-11-14(9-15(20)18(17)24-2)12-21-16(19(22)23)10-13-7-5-4-6-8-13/h4-9,11,16,21H,3,10,12H2,1-2H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | ZJRVUXPEQKAFKX-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |