C15H22ClNO4 — CID 99123968
(2R)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-methylbutanoic acid (PubChem CID 99123968) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 99123968 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2R)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-3-methylbutanoic acid |
| SMILES | CCOc1cc(CN[C@@H](C(=O)O)C(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C15H22ClNO4/c1-5-21-12-7-10(6-11(16)14(12)20-4)8-17-13(9(2)3)15(18)19/h6-7,9,13,17H,5,8H2,1-4H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | VPSZUNPBZUTCRK-CYBMUJFWSA-N |
| XLogP | 2.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |