C17H26ClNO4 — CID 66527405
2-[(3-chloro-4,5-diethoxyphenyl)methylamino]-4-methylpentanoic acid (PubChem CID 66527405) has the molecular formula C17H26ClNO4 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-[(3-chloro-4,5-diethoxyphenyl)methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(3-chloro-4,5-diethoxyphenyl)methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66527405 |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[(3-chloro-4,5-diethoxyphenyl)methylamino]-4-methylpentanoic acid |
| SMILES | CCOc1cc(CNC(CC(C)C)C(=O)O)cc(Cl)c1OCC |
| InChI | InChI=1S/C17H26ClNO4/c1-5-22-15-9-12(8-13(18)16(15)23-6-2)10-19-14(17(20)21)7-11(3)4/h8-9,11,14,19H,5-7,10H2,1-4H3,(H,20,21) |
| InChIKey | ZDDAQBQUKRPHEO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |