C15H24ClNO3 — CID 4717396
2-[(3-chloro-4,5-diethoxyphenyl)methylamino]butan-1-ol (PubChem CID 4717396) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 2-[(3-chloro-4,5-diethoxyphenyl)methylamino]butan-1-ol.
| Compound Name | 2-[(3-chloro-4,5-diethoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 4717396 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[(3-chloro-4,5-diethoxyphenyl)methylamino]butan-1-ol |
| SMILES | CCOc1cc(CNC(CC)CO)cc(Cl)c1OCC |
| InChI | InChI=1S/C15H24ClNO3/c1-4-12(10-18)17-9-11-7-13(16)15(20-6-3)14(8-11)19-5-2/h7-8,12,17-18H,4-6,9-10H2,1-3H3 |
| InChIKey | VPDCYZVBLKGEGF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |