C16H26BrNO3 — CID 29226823
(2S)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylamino]butan-1-ol (PubChem CID 29226823) has the molecular formula C16H26BrNO3 and a molecular weight of 360.29 g/mol. Its IUPAC name is (2S)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylamino]butan-1-ol.
| Compound Name | (2S)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 29226823 |
| Molecular Formula | C16H26BrNO3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (2S)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylamino]butan-1-ol |
| SMILES | CCCOc1c(Br)cc(CN[C@@H](CC)CO)cc1OCC |
| InChI | InChI=1S/C16H26BrNO3/c1-4-7-21-16-14(17)8-12(9-15(16)20-6-3)10-18-13(5-2)11-19/h8-9,13,18-19H,4-7,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | REGMLPSRMLUXOF-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |