C20H25BrFNO3 — CID 27236210
(2R)-2-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]butan-1-ol (PubChem CID 27236210) has the molecular formula C20H25BrFNO3 and a molecular weight of 426.33 g/mol. Its IUPAC name is (2R)-2-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 27236210 |
| Molecular Formula | C20H25BrFNO3 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (2R)-2-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]butan-1-ol |
| SMILES | CCOc1cc(CN[C@H](CC)CO)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25BrFNO3/c1-3-17(12-24)23-11-15-9-18(21)20(19(10-15)25-4-2)26-13-14-5-7-16(22)8-6-14/h5-10,17,23-24H,3-4,11-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | QYTQTUFWKUKJBB-QGZVFWFLSA-N |
| XLogP | 4.43 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |