C19H23BrClNO3 — CID 27236202
(2R)-2-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol (PubChem CID 27236202) has the molecular formula C19H23BrClNO3 and a molecular weight of 428.75 g/mol. Its IUPAC name is (2R)-2-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 27236202 |
| Molecular Formula | C19H23BrClNO3 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | (2R)-2-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NCc1cc(Br)c(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H23BrClNO3/c1-3-16(11-23)22-10-14-8-17(20)19(18(9-14)24-2)25-12-13-4-6-15(21)7-5-13/h4-9,16,22-23H,3,10-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | PRDZLRDDMPKQLM-MRXNPFEDSA-N |
| XLogP | 4.55 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |