C13H19Cl2NO2 — CID 4717389
2-[(3,5-dichloro-2-ethoxyphenyl)methylamino]butan-1-ol (PubChem CID 4717389) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-ethoxyphenyl)methylamino]butan-1-ol.
| Compound Name | 2-[(3,5-dichloro-2-ethoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 4717389 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[(3,5-dichloro-2-ethoxyphenyl)methylamino]butan-1-ol |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CNC(CC)CO |
| InChI | InChI=1S/C13H19Cl2NO2/c1-3-11(8-17)16-7-9-5-10(14)6-12(15)13(9)18-4-2/h5-6,11,16-17H,3-4,7-8H2,1-2H3 |
| InChIKey | UTDIICDUBHHJJG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |