C14H21Cl2NO2 — CID 29225195
(2R)-2-[(3,5-dichloro-2-propoxyphenyl)methylamino]butan-1-ol (PubChem CID 29225195) has the molecular formula C14H21Cl2NO2 and a molecular weight of 306.23 g/mol. Its IUPAC name is (2R)-2-[(3,5-dichloro-2-propoxyphenyl)methylamino]butan-1-ol.
| Compound Name | (2R)-2-[(3,5-dichloro-2-propoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 29225195 |
| Molecular Formula | C14H21Cl2NO2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2R)-2-[(3,5-dichloro-2-propoxyphenyl)methylamino]butan-1-ol |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CN[C@H](CC)CO |
| InChI | InChI=1S/C14H21Cl2NO2/c1-3-5-19-14-10(6-11(15)7-13(14)16)8-17-12(4-2)9-18/h6-7,12,17-18H,3-5,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | LEBXPRFLMFGNTP-GFCCVEGCSA-N |
| XLogP | 3.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |