C13H18Cl2O3 — CID 83941376
4-(3,5-dichloro-2-propoxyphenyl)butane-1,2-diol (PubChem CID 83941376) has the molecular formula C13H18Cl2O3 and a molecular weight of 293.19 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-propoxyphenyl)butane-1,2-diol.
| Compound Name | 4-(3,5-dichloro-2-propoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 83941376 |
| Molecular Formula | C13H18Cl2O3 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-(3,5-dichloro-2-propoxyphenyl)butane-1,2-diol |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CCC(O)CO |
| InChI | InChI=1S/C13H18Cl2O3/c1-2-5-18-13-9(3-4-11(17)8-16)6-10(14)7-12(13)15/h6-7,11,16-17H,2-5,8H2,1H3 |
| InChIKey | UCJZFHPBDJVEAB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |