C14H21ClO4 — CID 83943487
4-(5-chloro-2,4-diethoxyphenyl)butane-1,2-diol (PubChem CID 83943487) has the molecular formula C14H21ClO4 and a molecular weight of 288.77 g/mol. Its IUPAC name is 4-(5-chloro-2,4-diethoxyphenyl)butane-1,2-diol.
| Compound Name | 4-(5-chloro-2,4-diethoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 83943487 |
| Molecular Formula | C14H21ClO4 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-(5-chloro-2,4-diethoxyphenyl)butane-1,2-diol |
| SMILES | CCOc1cc(OCC)c(CCC(O)CO)cc1Cl |
| InChI | InChI=1S/C14H21ClO4/c1-3-18-13-8-14(19-4-2)12(15)7-10(13)5-6-11(17)9-16/h7-8,11,16-17H,3-6,9H2,1-2H3 |
| InChIKey | IIUDCYYAFYAIRS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |