C14H21ClO2S — CID 83943394
3-(5-chloro-2,4-diethoxyphenyl)-2-methylpropane-1-thiol (PubChem CID 83943394) has the molecular formula C14H21ClO2S and a molecular weight of 288.84 g/mol. Its IUPAC name is 3-(5-chloro-2,4-diethoxyphenyl)-2-methylpropane-1-thiol.
| Compound Name | 3-(5-chloro-2,4-diethoxyphenyl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 83943394 |
| Molecular Formula | C14H21ClO2S |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(5-chloro-2,4-diethoxyphenyl)-2-methylpropane-1-thiol |
| SMILES | CCOc1cc(OCC)c(CC(C)CS)cc1Cl |
| InChI | InChI=1S/C14H21ClO2S/c1-4-16-13-8-14(17-5-2)12(15)7-11(13)6-10(3)9-18/h7-8,10,18H,4-6,9H2,1-3H3 |
| InChIKey | SIDKWNSIUDOGHM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|