C15H23ClO4 — CID 83943497
5-(5-chloro-2,4-diethoxyphenyl)pentane-2,3-diol (PubChem CID 83943497) has the molecular formula C15H23ClO4 and a molecular weight of 302.80 g/mol. Its IUPAC name is 5-(5-chloro-2,4-diethoxyphenyl)pentane-2,3-diol.
| Compound Name | 5-(5-chloro-2,4-diethoxyphenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83943497 |
| Molecular Formula | C15H23ClO4 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-(5-chloro-2,4-diethoxyphenyl)pentane-2,3-diol |
| SMILES | CCOc1cc(OCC)c(CCC(O)C(C)O)cc1Cl |
| InChI | InChI=1S/C15H23ClO4/c1-4-19-14-9-15(20-5-2)12(16)8-11(14)6-7-13(18)10(3)17/h8-10,13,17-18H,4-7H2,1-3H3 |
| InChIKey | KMKRGJDXBLKSGQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |