C16H25ClO4 — CID 83943792
1-(2-chloro-4,5-diethoxyphenyl)hexane-3,4-diol (PubChem CID 83943792) has the molecular formula C16H25ClO4 and a molecular weight of 316.83 g/mol. Its IUPAC name is 1-(2-chloro-4,5-diethoxyphenyl)hexane-3,4-diol.
| Compound Name | 1-(2-chloro-4,5-diethoxyphenyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 83943792 |
| Molecular Formula | C16H25ClO4 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(2-chloro-4,5-diethoxyphenyl)hexane-3,4-diol |
| SMILES | CCOc1cc(Cl)c(CCC(O)C(O)CC)cc1OCC |
| InChI | InChI=1S/C16H25ClO4/c1-4-13(18)14(19)8-7-11-9-15(20-5-2)16(21-6-3)10-12(11)17/h9-10,13-14,18-19H,4-8H2,1-3H3 |
| InChIKey | WPMUIUKRGJNZKJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |