C14H19ClO2 — CID 83943749
1-but-3-enyl-2-chloro-4,5-diethoxybenzene (PubChem CID 83943749) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 1-but-3-enyl-2-chloro-4,5-diethoxybenzene.
| Compound Name | 1-but-3-enyl-2-chloro-4,5-diethoxybenzene |
|---|---|
| PubChem CID | 83943749 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-but-3-enyl-2-chloro-4,5-diethoxybenzene |
| SMILES | C=CCCc1cc(OCC)c(OCC)cc1Cl |
| InChI | InChI=1S/C14H19ClO2/c1-4-7-8-11-9-13(16-5-2)14(17-6-3)10-12(11)15/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | ALJJNHJXGNMCEY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|