C19H29ClNO2+ — CID 2238140
(2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium (PubChem CID 2238140) has the molecular formula C19H29ClNO2+ and a molecular weight of 338.90 g/mol. Its IUPAC name is (2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium.
| Compound Name | (2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 2238140 |
| Molecular Formula | C19H29ClNO2+ |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium |
| SMILES | C=CCOc1cc(Cl)c(C[NH2+][C@@H]2CCCC[C@H]2C)cc1OCC |
| InChI | InChI=1S/C19H28ClNO2/c1-4-10-23-19-12-16(20)15(11-18(19)22-5-2)13-21-17-9-7-6-8-14(17)3/h4,11-12,14,17,21H,1,5-10,13H2,2-3H3/p+1/t14-,17-/m1/s1 |
| InChIKey | FKFUXXZCMLHBJY-RHSMWYFYSA-O |
| XLogP | 3.95 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|