C18H18BrClO2 — CID 86728582
1-bromo-4-chloro-5-[(4-ethoxyphenyl)methyl]-2-prop-2-enoxybenzene (PubChem CID 86728582) has the molecular formula C18H18BrClO2 and a molecular weight of 381.70 g/mol. Its IUPAC name is 1-bromo-4-chloro-5-[(4-ethoxyphenyl)methyl]-2-prop-2-enoxybenzene.
| Compound Name | 1-bromo-4-chloro-5-[(4-ethoxyphenyl)methyl]-2-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 86728582 |
| Molecular Formula | C18H18BrClO2 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 1-bromo-4-chloro-5-[(4-ethoxyphenyl)methyl]-2-prop-2-enoxybenzene |
| SMILES | C=CCOc1cc(Cl)c(Cc2ccc(OCC)cc2)cc1Br |
| InChI | InChI=1S/C18H18BrClO2/c1-3-9-22-18-12-17(20)14(11-16(18)19)10-13-5-7-15(8-6-13)21-4-2/h3,5-8,11-12H,1,4,9-10H2,2H3 |
| InChIKey | SKMCZVZNSMWHFP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|