C17H16BrClO3 — CID 68554778
(5-bromo-2-chloro-4-prop-2-enoxyphenyl)-(4-methoxyphenyl)methanol (PubChem CID 68554778) has the molecular formula C17H16BrClO3 and a molecular weight of 383.67 g/mol. Its IUPAC name is (5-bromo-2-chloro-4-prop-2-enoxyphenyl)-(4-methoxyphenyl)methanol.
| Compound Name | (5-bromo-2-chloro-4-prop-2-enoxyphenyl)-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 68554778 |
| Molecular Formula | C17H16BrClO3 |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | (5-bromo-2-chloro-4-prop-2-enoxyphenyl)-(4-methoxyphenyl)methanol |
| SMILES | C=CCOc1cc(Cl)c(C(O)c2ccc(OC)cc2)cc1Br |
| InChI | InChI=1S/C17H16BrClO3/c1-3-8-22-16-10-15(19)13(9-14(16)18)17(20)11-4-6-12(21-2)7-5-11/h3-7,9-10,17,20H,1,8H2,2H3 |
| InChIKey | VETPFMNEPZOSIP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|