C21H26BrClO4 — CID 89319539
(5-bromo-4-butoxy-2-chlorophenyl)-[4-[2-(methoxymethoxy)ethyl]phenyl]methanol (PubChem CID 89319539) has the molecular formula C21H26BrClO4 and a molecular weight of 457.79 g/mol. Its IUPAC name is (5-bromo-4-butoxy-2-chlorophenyl)-[4-[2-(methoxymethoxy)ethyl]phenyl]methanol.
| Compound Name | (5-bromo-4-butoxy-2-chlorophenyl)-[4-[2-(methoxymethoxy)ethyl]phenyl]methanol |
|---|---|
| PubChem CID | 89319539 |
| Molecular Formula | C21H26BrClO4 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (5-bromo-4-butoxy-2-chlorophenyl)-[4-[2-(methoxymethoxy)ethyl]phenyl]methanol |
| SMILES | CCCCOc1cc(Cl)c(C(O)c2ccc(CCOCOC)cc2)cc1Br |
| InChI | InChI=1S/C21H26BrClO4/c1-3-4-10-27-20-13-19(23)17(12-18(20)22)21(24)16-7-5-15(6-8-16)9-11-26-14-25-2/h5-8,12-13,21,24H,3-4,9-11,14H2,1-2H3 |
| InChIKey | SEOQOTABGYBADF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|