C20H27ClO — CID 161337018
4-tert-butyl-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene;methane (PubChem CID 161337018) has the molecular formula C20H27ClO and a molecular weight of 318.89 g/mol. Its IUPAC name is 4-tert-butyl-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene;methane.
| Compound Name | 4-tert-butyl-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene;methane |
|---|---|
| PubChem CID | 161337018 |
| Molecular Formula | C20H27ClO |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-tert-butyl-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene;methane |
| SMILES | C.CCOc1ccc(Cc2cc(C(C)(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H23ClO.CH4/c1-5-21-17-9-6-14(7-10-17)12-15-13-16(19(2,3)4)8-11-18(15)20;/h6-11,13H,5,12H2,1-4H3;1H4 |
| InChIKey | VMDZIMUFCJDFRQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |