C21H25ClO2 — CID 90128332
(3S)-3-[4-[(5-tert-butyl-2-chlorophenyl)methyl]phenoxy]oxolane (PubChem CID 90128332) has the molecular formula C21H25ClO2 and a molecular weight of 344.88 g/mol. Its IUPAC name is (3S)-3-[4-[(5-tert-butyl-2-chlorophenyl)methyl]phenoxy]oxolane.
| Compound Name | (3S)-3-[4-[(5-tert-butyl-2-chlorophenyl)methyl]phenoxy]oxolane |
|---|---|
| PubChem CID | 90128332 |
| Molecular Formula | C21H25ClO2 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (3S)-3-[4-[(5-tert-butyl-2-chlorophenyl)methyl]phenoxy]oxolane |
| SMILES | CC(C)(C)c1ccc(Cl)c(Cc2ccc(O[C@H]3CCOC3)cc2)c1 |
| InChI | InChI=1S/C21H25ClO2/c1-21(2,3)17-6-9-20(22)16(13-17)12-15-4-7-18(8-5-15)24-19-10-11-23-14-19/h4-9,13,19H,10-12,14H2,1-3H3/t19-/m0/s1 |
| InChIKey | KJEVHDJXVKUQNA-IBGZPJMESA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |